C20H16ClNO3 — CID 11382641
9-(4-chlorobenzoyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 11382641) has the molecular formula C20H16ClNO3 and a molecular weight of 353.81 g/mol. Its IUPAC name is 9-(4-chlorobenzoyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-(4-chlorobenzoyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 11382641 |
| Molecular Formula | C20H16ClNO3 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 9-(4-chlorobenzoyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)c1c(n2C(=O)c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C20H16ClNO3/c21-14-8-5-12(6-9-14)19(23)22-17-4-2-1-3-15(17)16-11-13(20(24)25)7-10-18(16)22/h5-11H,1-4H2,(H,24,25) |
| InChIKey | GHFOXHAZUGKUCN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |