C21H28O5 — CID 11382847
[(6R,8S,9R,13S,14S,17S)-3,6,9-trihydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 11382847) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(6R,8S,9R,13S,14S,17S)-3,6,9-trihydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(6R,8S,9R,13S,14S,17S)-3,6,9-trihydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 11382847 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(6R,8S,9R,13S,14S,17S)-3,6,9-trihydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1CC[C@H]2[C@@H]3C[C@@H](O)c4cc(O)ccc4[C@@]3(O)CC[C@]12C |
| InChI | InChI=1S/C21H28O5/c1-3-19(24)26-18-7-6-15-16-11-17(23)13-10-12(22)4-5-14(13)21(16,25)9-8-20(15,18)2/h4-5,10,15-18,22-23,25H,3,6-9,11H2,1-2H3/t15-,16-,17+,18-,20-,21-/m0/s1 |
| InChIKey | OENMWUZKESPDFS-MROOBOTFSA-N |
| XLogP | 3.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |