About N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide
N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide (PubChem CID 1138293) has the molecular formula C17H16Br2N2O3
and a molecular weight of 456.13 g/mol. Its IUPAC name is N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide |
| PubChem CID | 1138293 |
| Molecular Formula | C17H16Br2N2O3 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide |
| SMILES | CCOc1cc(Br)c(Br)c(/C=N/c2ccc(NC(C)=O)cc2)c1O |
| InChI | InChI=1S/C17H16Br2N2O3/c1-3-24-15-8-14(18)16(19)13(17(15)23)9-20-11-4-6-12(7-5-11)21-10(2)22/h4-9,23H,3H2,1-2H3,(H,21,22)/b20-9+ |
| InChIKey | YDFUFFJFCBJFJC-AWQFTUOYSA-N |
| XLogP | 5.02 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide?
The IUPAC name of N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide (CID 1138293) is N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide.
What is the SMILES notation for N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide?
The canonical SMILES for N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide is CCOc1cc(Br)c(Br)c(/C=N/c2ccc(NC(C)=O)cc2)c1O.
What is the InChIKey of N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide?
The InChIKey is YDFUFFJFCBJFJC-AWQFTUOYSA-N. The full InChI is InChI=1S/C17H16Br2N2O3/c1-3-24-15-8-14(18)16(19)13(17(15)23)9-20-11-4-6-12(7-5-11)21-10(2)22/h4-9,23H,3H2,1-2H3,(H,21,22)/b20-9+.
What are the key properties of N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide?
N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide has a molecular weight of 456.13 g/mol, XLogP of 5.02, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]phenyl]acetamide is sourced from PubChem (CID 1138293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).