C23H30N2O2 — CID 11383004
(4R,4'aS,5R)-1'-cyclopentyl-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] (PubChem CID 11383004) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (4R,4'aS,5R)-1'-cyclopentyl-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole].
| Compound Name | (4R,4'aS,5R)-1'-cyclopentyl-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
|---|---|
| PubChem CID | 11383004 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (4R,4'aS,5R)-1'-cyclopentyl-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
| SMILES | C=C[C@H]1OC2(CCCC3=Cc4c(cnn4C4CCCC4)C[C@@]32C)O[C@@H]1C=C |
| InChI | InChI=1S/C23H30N2O2/c1-4-20-21(5-2)27-23(26-20)12-8-9-17-13-19-16(14-22(17,23)3)15-24-25(19)18-10-6-7-11-18/h4-5,13,15,18,20-21H,1-2,6-12,14H2,3H3/t20-,21-,22+/m1/s1 |
| InChIKey | NUPVXAQSTCMCAK-VSKRKVRLSA-N |
| XLogP | 4.98 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|