C14H13N11S — CID 11383018
1-[[3-[2-(diaminomethylidene)hydrazinyl]-14-thia-8,11,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaen-6-yl]imino]guanidine (PubChem CID 11383018) has the molecular formula C14H13N11S and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-[[3-[2-(diaminomethylidene)hydrazinyl]-14-thia-8,11,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaen-6-yl]imino]guanidine.
| Compound Name | 1-[[3-[2-(diaminomethylidene)hydrazinyl]-14-thia-8,11,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaen-6-yl]imino]guanidine |
|---|---|
| PubChem CID | 11383018 |
| Molecular Formula | C14H13N11S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[[3-[2-(diaminomethylidene)hydrazinyl]-14-thia-8,11,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaen-6-yl]imino]guanidine |
| SMILES | [H]/N=C(N)/N=N/c1ccc(NN=C(N)N)c2c1ncc1c2nc2sccn21 |
| InChI | InChI=1S/C14H13N11S/c15-12(16)23-21-6-1-2-7(22-24-13(17)18)10-9(6)11-8(5-19-10)25-3-4-26-14(25)20-11/h1-5,21H,(H3,17,18)(H4,15,16,23)/b24-22+ |
| InChIKey | OJVNIERSDOGAJR-ZNTNEXAZSA-N |
| XLogP | 1.67 |
| TPSA | 181.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|