C10H6BrCl3N4 — CID 11383047
3-bromo-5-(2,3,5-trichlorophenyl)pyrazine-2,6-diamine (PubChem CID 11383047) has the molecular formula C10H6BrCl3N4 and a molecular weight of 368.45 g/mol. Its IUPAC name is 3-bromo-5-(2,3,5-trichlorophenyl)pyrazine-2,6-diamine.
| Compound Name | 3-bromo-5-(2,3,5-trichlorophenyl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 11383047 |
| Molecular Formula | C10H6BrCl3N4 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 365.88 |
| IUPAC Name | 3-bromo-5-(2,3,5-trichlorophenyl)pyrazine-2,6-diamine |
| SMILES | Nc1nc(N)c(-c2cc(Cl)cc(Cl)c2Cl)nc1Br |
| InChI | InChI=1S/C10H6BrCl3N4/c11-8-10(16)18-9(15)7(17-8)4-1-3(12)2-5(13)6(4)14/h1-2H,(H4,15,16,18) |
| InChIKey | FOZHLJAOQPMVIN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|