C12H22O9S2 — CID 11383230
[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl] sulfate (PubChem CID 11383230) has the molecular formula C12H22O9S2 and a molecular weight of 374.43 g/mol. Its IUPAC name is [(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl] sulfate.
| Compound Name | [(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl] sulfate |
|---|---|
| PubChem CID | 11383230 |
| Molecular Formula | C12H22O9S2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl] sulfate |
| SMILES | CC1(C)OC[C@H](OS(=O)(=O)[O-])[C@@H](C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)O1 |
| InChI | InChI=1S/C12H22O9S2/c1-12(2)19-4-8(21-23(16,17)18)9(20-12)6-22-5-7(14)11(15)10(22)3-13/h7-11,13-15H,3-6H2,1-2H3/t7-,8+,9-,10-,11+,22?/m1/s1 |
| InChIKey | SRMCEORFLQUTFI-MBHZOIENSA-N |
| XLogP | -2.30 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|