C12H23O9S2+ — CID 11383231
[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl] hydrogen sulfate (PubChem CID 11383231) has the molecular formula C12H23O9S2+ and a molecular weight of 375.44 g/mol. Its IUPAC name is [(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl] hydrogen sulfate.
| Compound Name | [(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 11383231 |
| Molecular Formula | C12H23O9S2+ |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl] hydrogen sulfate |
| SMILES | CC1(C)OC[C@H](OS(=O)(=O)O)[C@@H](C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)O1 |
| InChI | InChI=1S/C12H22O9S2/c1-12(2)19-4-8(21-23(16,17)18)9(20-12)6-22-5-7(14)11(15)10(22)3-13/h7-11,13-15H,3-6H2,1-2H3/p+1/t7-,8+,9-,10-,11+,22?/m1/s1 |
| InChIKey | SRMCEORFLQUTFI-MBHZOIENSA-O |
| XLogP | -1.96 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|