C14H15Cl2FN4OS — CID 11383327
5-(2,4-dichloro-5-fluorophenyl)-3-[(4-methylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 11383327) has the molecular formula C14H15Cl2FN4OS and a molecular weight of 377.27 g/mol. Its IUPAC name is 5-(2,4-dichloro-5-fluorophenyl)-3-[(4-methylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2,4-dichloro-5-fluorophenyl)-3-[(4-methylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 11383327 |
| Molecular Formula | C14H15Cl2FN4OS |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 5-(2,4-dichloro-5-fluorophenyl)-3-[(4-methylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | CN1CCN(Cn2nc(-c3cc(F)c(Cl)cc3Cl)oc2=S)CC1 |
| InChI | InChI=1S/C14H15Cl2FN4OS/c1-19-2-4-20(5-3-19)8-21-14(23)22-13(18-21)9-6-12(17)11(16)7-10(9)15/h6-7H,2-5,8H2,1H3 |
| InChIKey | AKPHPWMTQQJADP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|