C22H36O4Si — CID 11383795
methyl (1S,4R,5S)-4-hydroxy-8,8-dimethyl-9-oxo-5-prop-2-enyl-3-triethylsilylbicyclo[3.3.1]non-2-ene-1-carboxylate (PubChem CID 11383795) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is methyl (1S,4R,5S)-4-hydroxy-8,8-dimethyl-9-oxo-5-prop-2-enyl-3-triethylsilylbicyclo[3.3.1]non-2-ene-1-carboxylate.
| Compound Name | methyl (1S,4R,5S)-4-hydroxy-8,8-dimethyl-9-oxo-5-prop-2-enyl-3-triethylsilylbicyclo[3.3.1]non-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 11383795 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | methyl (1S,4R,5S)-4-hydroxy-8,8-dimethyl-9-oxo-5-prop-2-enyl-3-triethylsilylbicyclo[3.3.1]non-2-ene-1-carboxylate |
| SMILES | C=CC[C@@]12CCC(C)(C)[C@@](C(=O)OC)(C=C([Si](CC)(CC)CC)[C@@H]1O)C2=O |
| InChI | InChI=1S/C22H36O4Si/c1-8-12-21-14-13-20(5,6)22(18(21)24,19(25)26-7)15-16(17(21)23)27(9-2,10-3)11-4/h8,15,17,23H,1,9-14H2,2-7H3/t17-,21+,22-/m0/s1 |
| InChIKey | ZEFBDFUBMAIDSR-WTOYTKOKSA-N |
| XLogP | 4.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|