C24H24N2O4 — CID 11384154
ethyl (5R,7S)-1,3-dibenzyl-2,4-dioxo-1,3-diazaspiro[4.4]non-8-ene-7-carboxylate (PubChem CID 11384154) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl (5R,7S)-1,3-dibenzyl-2,4-dioxo-1,3-diazaspiro[4.4]non-8-ene-7-carboxylate.
| Compound Name | ethyl (5R,7S)-1,3-dibenzyl-2,4-dioxo-1,3-diazaspiro[4.4]non-8-ene-7-carboxylate |
|---|---|
| PubChem CID | 11384154 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl (5R,7S)-1,3-dibenzyl-2,4-dioxo-1,3-diazaspiro[4.4]non-8-ene-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C=C[C@]2(C1)C(=O)N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c1-2-30-21(27)20-13-14-24(15-20)22(28)25(16-18-9-5-3-6-10-18)23(29)26(24)17-19-11-7-4-8-12-19/h3-14,20H,2,15-17H2,1H3/t20-,24+/m1/s1 |
| InChIKey | UWYQONCTGNXOAX-YKSBVNFPSA-N |
| XLogP | 3.53 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|