C25H26O5 — CID 11384221
(2S,3S,4S,5R)-2-methoxy-5-(trityloxymethyl)oxolane-3,4-diol (PubChem CID 11384221) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-methoxy-5-(trityloxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-methoxy-5-(trityloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11384221 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2S,3S,4S,5R)-2-methoxy-5-(trityloxymethyl)oxolane-3,4-diol |
| SMILES | CO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H26O5/c1-28-24-23(27)22(26)21(30-24)17-29-25(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21-24,26-27H,17H2,1H3/t21-,22-,23+,24+/m1/s1 |
| InChIKey | ZFZBMSNSNORRPT-LWSSLDFYSA-N |
| XLogP | 3.09 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|