C21H22ClN7 — CID 11384258
N-(2-chloro-6-methylphenyl)-12-[(3R)-3-methylpiperazin-1-yl]-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine (PubChem CID 11384258) has the molecular formula C21H22ClN7 and a molecular weight of 407.91 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-12-[(3R)-3-methylpiperazin-1-yl]-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine.
| Compound Name | N-(2-chloro-6-methylphenyl)-12-[(3R)-3-methylpiperazin-1-yl]-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 11384258 |
| Molecular Formula | C21H22ClN7 |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-12-[(3R)-3-methylpiperazin-1-yl]-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
| SMILES | Cc1cccc(Cl)c1Nc1nc2ccc(N3CCN[C@H](C)C3)nc2n2cncc12 |
| InChI | InChI=1S/C21H22ClN7/c1-13-4-3-5-15(22)19(13)27-20-17-10-23-12-29(17)21-16(25-20)6-7-18(26-21)28-9-8-24-14(2)11-28/h3-7,10,12,14,24H,8-9,11H2,1-2H3,(H,25,27)/t14-/m1/s1 |
| InChIKey | PUNYTBZWCMNSRO-CQSZACIVSA-N |
| XLogP | 3.78 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |