C21H38O6Si — CID 11384450
(2R,4S,6S,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-8-(2-oxobutyl)-1,7-dioxaspiro[5.5]undecane-2-carbaldehyde (PubChem CID 11384450) has the molecular formula C21H38O6Si and a molecular weight of 414.62 g/mol. Its IUPAC name is (2R,4S,6S,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-8-(2-oxobutyl)-1,7-dioxaspiro[5.5]undecane-2-carbaldehyde.
| Compound Name | (2R,4S,6S,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-8-(2-oxobutyl)-1,7-dioxaspiro[5.5]undecane-2-carbaldehyde |
|---|---|
| PubChem CID | 11384450 |
| Molecular Formula | C21H38O6Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2R,4S,6S,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-8-(2-oxobutyl)-1,7-dioxaspiro[5.5]undecane-2-carbaldehyde |
| SMILES | CCC(=O)C[C@@H]1C[C@H](OC)C[C@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](C=O)O2)O1 |
| InChI | InChI=1S/C21H38O6Si/c1-8-15(23)9-16-10-17(24-5)12-21(25-16)13-18(11-19(14-22)26-21)27-28(6,7)20(2,3)4/h14,16-19H,8-13H2,1-7H3/t16-,17+,18+,19-,21+/m1/s1 |
| InChIKey | WGQSQPIIVLHHFY-CWVBCOCOSA-N |
| XLogP | 4.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|