About 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane
2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane (PubChem CID 11384508) has the molecular formula C28H24N2Si
and a molecular weight of 416.60 g/mol. Its IUPAC name is 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane.
Molecular Properties
| Compound Name | 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane |
| PubChem CID | 11384508 |
| Molecular Formula | C28H24N2Si |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane |
| SMILES | C[Si](C)(C=C(c1cccc2ccccc12)c1cccc2ccccc12)c1ncccn1 |
| InChI | InChI=1S/C28H24N2Si/c1-31(2,28-29-18-9-19-30-28)20-27(25-16-7-12-21-10-3-5-14-23(21)25)26-17-8-13-22-11-4-6-15-24(22)26/h3-20H,1-2H3 |
| InChIKey | CLQPFYAAWVRTNV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane?
The IUPAC name of 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane (CID 11384508) is 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane.
What is the SMILES notation for 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane?
The canonical SMILES for 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane is C[Si](C)(C=C(c1cccc2ccccc12)c1cccc2ccccc12)c1ncccn1.
What is the InChIKey of 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane?
The InChIKey is CLQPFYAAWVRTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N2Si/c1-31(2,28-29-18-9-19-30-28)20-27(25-16-7-12-21-10-3-5-14-23(21)25)26-17-8-13-22-11-4-6-15-24(22)26/h3-20H,1-2H3.
What are the key properties of 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane?
2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane has a molecular weight of 416.60 g/mol, XLogP of 6.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane is sourced from PubChem (CID 11384508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).