C28H24N2Si — CID 11384508
2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane (PubChem CID 11384508) has the molecular formula C28H24N2Si and a molecular weight of 416.60 g/mol. Its IUPAC name is 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane.
| Compound Name | 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane |
|---|---|
| PubChem CID | 11384508 |
| Molecular Formula | C28H24N2Si |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2,2-dinaphthalen-1-ylethenyl-dimethyl-pyrimidin-2-ylsilane |
| SMILES | C[Si](C)(C=C(c1cccc2ccccc12)c1cccc2ccccc12)c1ncccn1 |
| InChI | InChI=1S/C28H24N2Si/c1-31(2,28-29-18-9-19-30-28)20-27(25-16-7-12-21-10-3-5-14-23(21)25)26-17-8-13-22-11-4-6-15-24(22)26/h3-20H,1-2H3 |
| InChIKey | CLQPFYAAWVRTNV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|