C24H36O6 — CID 11384628
[(E,1R,4R)-1-acetyloxy-1-[(1R,2R)-2-[(2S,4Z)-9-oxo-3,6,7,8-tetrahydro-2H-oxonin-2-yl]cyclopropyl]non-2-en-4-yl] acetate (PubChem CID 11384628) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is [(E,1R,4R)-1-acetyloxy-1-[(1R,2R)-2-[(2S,4Z)-9-oxo-3,6,7,8-tetrahydro-2H-oxonin-2-yl]cyclopropyl]non-2-en-4-yl] acetate.
| Compound Name | [(E,1R,4R)-1-acetyloxy-1-[(1R,2R)-2-[(2S,4Z)-9-oxo-3,6,7,8-tetrahydro-2H-oxonin-2-yl]cyclopropyl]non-2-en-4-yl] acetate |
|---|---|
| PubChem CID | 11384628 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(E,1R,4R)-1-acetyloxy-1-[(1R,2R)-2-[(2S,4Z)-9-oxo-3,6,7,8-tetrahydro-2H-oxonin-2-yl]cyclopropyl]non-2-en-4-yl] acetate |
| SMILES | CCCCC[C@H](/C=C/[C@@H](OC(C)=O)[C@@H]1C[C@H]1[C@@H]1C/C=C\CCCC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C24H36O6/c1-4-5-8-11-19(28-17(2)25)14-15-23(29-18(3)26)21-16-20(21)22-12-9-6-7-10-13-24(27)30-22/h6,9,14-15,19-23H,4-5,7-8,10-13,16H2,1-3H3/b9-6-,15-14+/t19-,20-,21-,22+,23-/m1/s1 |
| InChIKey | QNLGCRPMSYPFMQ-CIMYEONXSA-N |
| XLogP | 4.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|