C29H44O2 — CID 11384729
(3R,3aR,5R,8S,11bR)-3-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-5-methoxy-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracen-8-ol (PubChem CID 11384729) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is (3R,3aR,5R,8S,11bR)-3-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-5-methoxy-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracen-8-ol.
| Compound Name | (3R,3aR,5R,8S,11bR)-3-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-5-methoxy-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracen-8-ol |
|---|---|
| PubChem CID | 11384729 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | (3R,3aR,5R,8S,11bR)-3-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-5-methoxy-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracen-8-ol |
| SMILES | CO[C@@H]1C[C@]2(C)[C@@H]([C@H](C)/C=C/[C@H](C)C(C)C)CC[C@H]2c2cc3c(c(C)c21)C[C@@H](O)CC3 |
| InChI | InChI=1S/C29H44O2/c1-17(2)18(3)8-9-19(4)25-12-13-26-24-14-21-10-11-22(30)15-23(21)20(5)28(24)27(31-7)16-29(25,26)6/h8-9,14,17-19,22,25-27,30H,10-13,15-16H2,1-7H3/b9-8+/t18-,19+,22-,25+,26-,27+,29+/m0/s1 |
| InChIKey | QATMLMHKOKQDMW-YREZGCQNSA-N |
| XLogP | 6.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|