C19H29F3O7 — CID 11384771
3-[[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propane-1,2-diol (PubChem CID 11384771) has the molecular formula C19H29F3O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is 3-[[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propane-1,2-diol.
| Compound Name | 3-[[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propane-1,2-diol |
|---|---|
| PubChem CID | 11384771 |
| Molecular Formula | C19H29F3O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-[[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propane-1,2-diol |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@](OCC(O)CO)(C(F)(F)F)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C19H29F3O7/c1-10-4-5-14-11(2)18(19(20,21)22,25-9-12(24)8-23)27-15-17(14)13(10)6-7-16(3,26-15)28-29-17/h10-15,23-24H,4-9H2,1-3H3/t10-,11-,12?,13+,14?,15+,16+,17-,18-/m1/s1 |
| InChIKey | PWAZQZUXROLVEY-BJYJPCOXSA-N |
| XLogP | 2.50 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|