C29H46O2 — CID 11384803
(2S)-2-[(E,1R,2S)-2-methyl-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pent-3-enyl]cyclohexan-1-one (PubChem CID 11384803) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (2S)-2-[(E,1R,2S)-2-methyl-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pent-3-enyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(E,1R,2S)-2-methyl-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pent-3-enyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 11384803 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (2S)-2-[(E,1R,2S)-2-methyl-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pent-3-enyl]cyclohexan-1-one |
| SMILES | C/C=C/[C@H](C)[C@@H](O[C@H](C)c1c(C(C)C)cc(C(C)C)cc1C(C)C)[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C29H46O2/c1-10-13-21(8)29(24-14-11-12-15-27(24)30)31-22(9)28-25(19(4)5)16-23(18(2)3)17-26(28)20(6)7/h10,13,16-22,24,29H,11-12,14-15H2,1-9H3/b13-10+/t21-,22+,24+,29+/m0/s1 |
| InChIKey | MPRFVCLLUSRJHL-VENXPGQZSA-N |
| XLogP | 8.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|