C19H15Cl2NO5S — CID 11385137
[(3aS,4R,6aS)-3-(2,6-dichlorophenyl)-4-hydroxy-4,6a-dihydro-3aH-cyclopenta[d][1,2]oxazol-6-yl] 4-methylbenzenesulfonate (PubChem CID 11385137) has the molecular formula C19H15Cl2NO5S and a molecular weight of 440.30 g/mol. Its IUPAC name is [(3aS,4R,6aS)-3-(2,6-dichlorophenyl)-4-hydroxy-4,6a-dihydro-3aH-cyclopenta[d][1,2]oxazol-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3aS,4R,6aS)-3-(2,6-dichlorophenyl)-4-hydroxy-4,6a-dihydro-3aH-cyclopenta[d][1,2]oxazol-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11385137 |
| Molecular Formula | C19H15Cl2NO5S |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | [(3aS,4R,6aS)-3-(2,6-dichlorophenyl)-4-hydroxy-4,6a-dihydro-3aH-cyclopenta[d][1,2]oxazol-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2=C[C@H](O)[C@@H]3C(c4c(Cl)cccc4Cl)=NO[C@H]23)cc1 |
| InChI | InChI=1S/C19H15Cl2NO5S/c1-10-5-7-11(8-6-10)28(24,25)27-15-9-14(23)17-18(22-26-19(15)17)16-12(20)3-2-4-13(16)21/h2-9,14,17,19,23H,1H3/t14-,17+,19+/m0/s1 |
| InChIKey | VMECGAQCNVXFNZ-POZUXBRTSA-N |
| XLogP | 3.68 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|