C22H24N2O6S — CID 11385239
(5R,14R)-5,14-diethyl-3,16-dioxa-23-thia-6,13-diazatricyclo[16.3.1.18,11]tricosa-1(22),8,10,18,20-pentaene-2,7,12,17-tetrone (PubChem CID 11385239) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is (5R,14R)-5,14-diethyl-3,16-dioxa-23-thia-6,13-diazatricyclo[16.3.1.18,11]tricosa-1(22),8,10,18,20-pentaene-2,7,12,17-tetrone.
| Compound Name | (5R,14R)-5,14-diethyl-3,16-dioxa-23-thia-6,13-diazatricyclo[16.3.1.18,11]tricosa-1(22),8,10,18,20-pentaene-2,7,12,17-tetrone |
|---|---|
| PubChem CID | 11385239 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (5R,14R)-5,14-diethyl-3,16-dioxa-23-thia-6,13-diazatricyclo[16.3.1.18,11]tricosa-1(22),8,10,18,20-pentaene-2,7,12,17-tetrone |
| SMILES | CC[C@@H]1COC(=O)c2cccc(c2)C(=O)OC[C@@H](CC)NC(=O)c2ccc(s2)C(=O)N1 |
| InChI | InChI=1S/C22H24N2O6S/c1-3-15-11-29-21(27)13-6-5-7-14(10-13)22(28)30-12-16(4-2)24-20(26)18-9-8-17(31-18)19(25)23-15/h5-10,15-16H,3-4,11-12H2,1-2H3,(H,23,25)(H,24,26)/t15-,16-/m1/s1 |
| InChIKey | WEHZHULCMROUAH-HZPDHXFCSA-N |
| XLogP | 2.79 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |