C19H12N2O5S3 — CID 11385240
dimethyl 2-[(3-formylthieno[3,4-b]quinoxalin-1-yl)methylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11385240) has the molecular formula C19H12N2O5S3 and a molecular weight of 444.52 g/mol. Its IUPAC name is dimethyl 2-[(3-formylthieno[3,4-b]quinoxalin-1-yl)methylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[(3-formylthieno[3,4-b]quinoxalin-1-yl)methylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11385240 |
| Molecular Formula | C19H12N2O5S3 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | dimethyl 2-[(3-formylthieno[3,4-b]quinoxalin-1-yl)methylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=Cc2sc(C=O)c3nc4ccccc4nc23)S1 |
| InChI | InChI=1S/C19H12N2O5S3/c1-25-18(23)16-17(19(24)26-2)29-13(28-16)7-11-14-15(12(8-22)27-11)21-10-6-4-3-5-9(10)20-14/h3-8H,1-2H3 |
| InChIKey | LHQUOYPQTYZBRG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|