C25H40O5Si — CID 11385355
methyl (E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4R,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]hept-2-enoate (PubChem CID 11385355) has the molecular formula C25H40O5Si and a molecular weight of 448.68 g/mol. Its IUPAC name is methyl (E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4R,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]hept-2-enoate.
| Compound Name | methyl (E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4R,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]hept-2-enoate |
|---|---|
| PubChem CID | 11385355 |
| Molecular Formula | C25H40O5Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | methyl (E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4R,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]hept-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]1OC(C)(C)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H40O5Si/c1-18(22-23(29-25(5,6)28-22)19-14-11-10-12-15-19)20(16-13-17-21(26)27-7)30-31(8,9)24(2,3)4/h10-15,17-18,20,22-23H,16H2,1-9H3/b17-13+/t18-,20-,22+,23+/m0/s1 |
| InChIKey | FKELPNCLZKTBBO-IENDTBRFSA-N |
| XLogP | 6.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|