C26H31N3O2S — CID 11385380
3-[6-(4-phenylpiperazin-1-yl)hexyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 11385380) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 3-[6-(4-phenylpiperazin-1-yl)hexyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[6-(4-phenylpiperazin-1-yl)hexyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 11385380 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 3-[6-(4-phenylpiperazin-1-yl)hexyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1CCCCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O2S/c30-32(31)25-15-9-11-22-10-8-14-24(26(22)25)29(32)17-7-2-1-6-16-27-18-20-28(21-19-27)23-12-4-3-5-13-23/h3-5,8-15H,1-2,6-7,16-21H2 |
| InChIKey | JEPPJTWOSHWDBB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|