C25H30N2O4S — CID 11385498
4-[4-[[6-methyl-2-(2,4,6-trimethylanilino)-3-pyridinyl]sulfonyl]phenoxy]butan-1-ol (PubChem CID 11385498) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is 4-[4-[[6-methyl-2-(2,4,6-trimethylanilino)-3-pyridinyl]sulfonyl]phenoxy]butan-1-ol.
| Compound Name | 4-[4-[[6-methyl-2-(2,4,6-trimethylanilino)-3-pyridinyl]sulfonyl]phenoxy]butan-1-ol |
|---|---|
| PubChem CID | 11385498 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-[4-[[6-methyl-2-(2,4,6-trimethylanilino)-3-pyridinyl]sulfonyl]phenoxy]butan-1-ol |
| SMILES | Cc1cc(C)c(Nc2nc(C)ccc2S(=O)(=O)c2ccc(OCCCCO)cc2)c(C)c1 |
| InChI | InChI=1S/C25H30N2O4S/c1-17-15-18(2)24(19(3)16-17)27-25-23(12-7-20(4)26-25)32(29,30)22-10-8-21(9-11-22)31-14-6-5-13-28/h7-12,15-16,28H,5-6,13-14H2,1-4H3,(H,26,27) |
| InChIKey | PTQCXCFNRRUBCU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|