C26H24Cl2O3 — CID 11385517
(1S,2'E,4R,5'E)-2',5'-bis[(4-chlorophenyl)methylidene]-1,6,6-trimethylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,1'-cyclopentane]-5-one (PubChem CID 11385517) has the molecular formula C26H24Cl2O3 and a molecular weight of 455.38 g/mol. Its IUPAC name is (1S,2'E,4R,5'E)-2',5'-bis[(4-chlorophenyl)methylidene]-1,6,6-trimethylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,1'-cyclopentane]-5-one.
| Compound Name | (1S,2'E,4R,5'E)-2',5'-bis[(4-chlorophenyl)methylidene]-1,6,6-trimethylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,1'-cyclopentane]-5-one |
|---|---|
| PubChem CID | 11385517 |
| Molecular Formula | C26H24Cl2O3 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (1S,2'E,4R,5'E)-2',5'-bis[(4-chlorophenyl)methylidene]-1,6,6-trimethylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,1'-cyclopentane]-5-one |
| SMILES | CC1(C)C(=O)[C@@H]2O[C@@]1(C)OC21/C(=C/c2ccc(Cl)cc2)CC/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24Cl2O3/c1-24(2)22(29)23-26(31-25(24,3)30-23)18(14-16-4-10-20(27)11-5-16)8-9-19(26)15-17-6-12-21(28)13-7-17/h4-7,10-15,23H,8-9H2,1-3H3/b18-14+,19-15+/t23-,25-/m0/s1 |
| InChIKey | PSIABSWFKCGPGA-JMZXGFRASA-N |
| XLogP | 6.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |