C25H35N3OS2 — CID 11385572
5-(dithiolan-3-yl)-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]pentanamide (PubChem CID 11385572) has the molecular formula C25H35N3OS2 and a molecular weight of 457.71 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]pentanamide |
|---|---|
| PubChem CID | 11385572 |
| Molecular Formula | C25H35N3OS2 |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C25H35N3OS2/c29-24(14-6-1-9-19-15-18-30-31-19)26-16-7-8-17-27-25-20-10-2-4-12-22(20)28-23-13-5-3-11-21(23)25/h2,4,10,12,19H,1,3,5-9,11,13-18H2,(H,26,29)(H,27,28) |
| InChIKey | IEBFRRATFZBOGS-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|