About N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide (PubChem CID 1138595) has the molecular formula C21H18N2O5S
and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide |
| PubChem CID | 1138595 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide |
| SMILES | COc1ccc(OC)c(-c2csc(N(Cc3ccco3)C(=O)c3ccco3)n2)c1 |
| InChI | InChI=1S/C21H18N2O5S/c1-25-14-7-8-18(26-2)16(11-14)17-13-29-21(22-17)23(12-15-5-3-9-27-15)20(24)19-6-4-10-28-19/h3-11,13H,12H2,1-2H3 |
| InChIKey | AZWHAYFDCDXHRD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide?
The IUPAC name of N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide (CID 1138595) is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide.
What is the SMILES notation for N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide?
The canonical SMILES for N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide is COc1ccc(OC)c(-c2csc(N(Cc3ccco3)C(=O)c3ccco3)n2)c1.
What is the InChIKey of N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide?
The InChIKey is AZWHAYFDCDXHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O5S/c1-25-14-7-8-18(26-2)16(11-14)17-13-29-21(22-17)23(12-15-5-3-9-27-15)20(24)19-6-4-10-28-19/h3-11,13H,12H2,1-2H3.
What are the key properties of N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide?
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide has a molecular weight of 410.45 g/mol, XLogP of 4.86, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)furan-2-carboxamide is sourced from PubChem (CID 1138595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).