C23H35N3O6Si — CID 11386024
ethyl (4R,5S,6R)-6-acetyloxy-4-azido-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[dimethyl(phenyl)silyl]hexanoate (PubChem CID 11386024) has the molecular formula C23H35N3O6Si and a molecular weight of 477.63 g/mol. Its IUPAC name is ethyl (4R,5S,6R)-6-acetyloxy-4-azido-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[dimethyl(phenyl)silyl]hexanoate.
| Compound Name | ethyl (4R,5S,6R)-6-acetyloxy-4-azido-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[dimethyl(phenyl)silyl]hexanoate |
|---|---|
| PubChem CID | 11386024 |
| Molecular Formula | C23H35N3O6Si |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | ethyl (4R,5S,6R)-6-acetyloxy-4-azido-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[dimethyl(phenyl)silyl]hexanoate |
| SMILES | CCOC(=O)CC[C@@H](N=[N+]=[N-])[C@@H]([C@H](OC(C)=O)[C@H]1COC(C)(C)O1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H35N3O6Si/c1-7-29-20(28)14-13-18(25-26-24)22(33(5,6)17-11-9-8-10-12-17)21(31-16(2)27)19-15-30-23(3,4)32-19/h8-12,18-19,21-22H,7,13-15H2,1-6H3/t18-,19-,21-,22+/m1/s1 |
| InChIKey | FDHRRAHLFBSVQJ-CZAYHTPWSA-N |
| XLogP | 4.08 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|