C24H27N3O6S — CID 11386186
3-O-tert-butyl 6-O-ethyl 2-amino-5-[(1,3-dioxoisoindol-2-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 11386186) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is 3-O-tert-butyl 6-O-ethyl 2-amino-5-[(1,3-dioxoisoindol-2-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | 3-O-tert-butyl 6-O-ethyl 2-amino-5-[(1,3-dioxoisoindol-2-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 11386186 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 3-O-tert-butyl 6-O-ethyl 2-amino-5-[(1,3-dioxoisoindol-2-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CCOC(=O)N1Cc2sc(N)c(C(=O)OC(C)(C)C)c2CC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H27N3O6S/c1-5-32-23(31)26-12-17-16(18(19(25)34-17)22(30)33-24(2,3)4)10-13(26)11-27-20(28)14-8-6-7-9-15(14)21(27)29/h6-9,13H,5,10-12,25H2,1-4H3 |
| InChIKey | SUCFEBRBKJNZFR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|