C28H42O5Si — CID 11386213
(2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-3-(methoxymethoxy)-5,5-dimethylhept-6-en-2-ol (PubChem CID 11386213) has the molecular formula C28H42O5Si and a molecular weight of 486.73 g/mol. Its IUPAC name is (2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-3-(methoxymethoxy)-5,5-dimethylhept-6-en-2-ol.
| Compound Name | (2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-3-(methoxymethoxy)-5,5-dimethylhept-6-en-2-ol |
|---|---|
| PubChem CID | 11386213 |
| Molecular Formula | C28H42O5Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-3-(methoxymethoxy)-5,5-dimethylhept-6-en-2-ol |
| SMILES | C=CC(C)(C)[C@H](OC)[C@@H](OCOC)[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42O5Si/c1-9-28(5,6)26(31-8)25(32-21-30-7)24(29)20-33-34(27(2,3)4,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h9-19,24-26,29H,1,20-21H2,2-8H3/t24-,25+,26-/m1/s1 |
| InChIKey | XWQCQZVPAWXIFR-UODIDJSMSA-N |
| XLogP | 4.14 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|