C29H33N5O3 — CID 11386471
[4-[[4-(piperidin-1-ylmethyl)benzoyl]amino]phenyl] 4-pyridin-2-ylpiperazine-1-carboxylate (PubChem CID 11386471) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is [4-[[4-(piperidin-1-ylmethyl)benzoyl]amino]phenyl] 4-pyridin-2-ylpiperazine-1-carboxylate.
| Compound Name | [4-[[4-(piperidin-1-ylmethyl)benzoyl]amino]phenyl] 4-pyridin-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 11386471 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | [4-[[4-(piperidin-1-ylmethyl)benzoyl]amino]phenyl] 4-pyridin-2-ylpiperazine-1-carboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)N2CCN(c3ccccn3)CC2)cc1)c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C29H33N5O3/c35-28(24-9-7-23(8-10-24)22-32-16-4-1-5-17-32)31-25-11-13-26(14-12-25)37-29(36)34-20-18-33(19-21-34)27-6-2-3-15-30-27/h2-3,6-15H,1,4-5,16-22H2,(H,31,35) |
| InChIKey | GZLNBACKSOFEOZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |