C19H16Co2O10 — CID 11386866
[(4R,7S)-7-acetyloxynona-1,8-dien-5-yn-4-yl] acetate;carbon monoxide;cobalt (PubChem CID 11386866) has the molecular formula C19H16Co2O10 and a molecular weight of 522.19 g/mol. Its IUPAC name is [(4R,7S)-7-acetyloxynona-1,8-dien-5-yn-4-yl] acetate;carbon monoxide;cobalt.
| Compound Name | [(4R,7S)-7-acetyloxynona-1,8-dien-5-yn-4-yl] acetate;carbon monoxide;cobalt |
|---|---|
| PubChem CID | 11386866 |
| Molecular Formula | C19H16Co2O10 |
| Molecular Weight | 522.19 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | [(4R,7S)-7-acetyloxynona-1,8-dien-5-yn-4-yl] acetate;carbon monoxide;cobalt |
| SMILES | C=CC[C@H](C#C[C@H](C=C)OC(C)=O)OC(C)=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co] |
| InChI | InChI=1S/C13H16O4.6CO.2Co/c1-5-7-13(17-11(4)15)9-8-12(6-2)16-10(3)14;6*1-2;;/h5-6,12-13H,1-2,7H2,3-4H3;;;;;;;;/t12-,13+;;;;;;;;/m0......../s1 |
| InChIKey | ZHKGAONKEROHOB-LOBCFUQESA-N |
| XLogP | 1.39 |
| TPSA | 172.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|