C23H46N4O6Si2 — CID 11387017
tert-butyl (4R)-4-[(1R,2S)-3-azido-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 11387017) has the molecular formula C23H46N4O6Si2 and a molecular weight of 530.82 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1R,2S)-3-azido-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1R,2S)-3-azido-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11387017 |
| Molecular Formula | C23H46N4O6Si2 |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | tert-butyl (4R)-4-[(1R,2S)-3-azido-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)OC[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CN=[N+]=[N-])O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46N4O6Si2/c1-21(2,3)31-20(29)27-16(15-30-19(27)28)18(33-35(12,13)23(7,8)9)17(14-25-26-24)32-34(10,11)22(4,5)6/h16-18H,14-15H2,1-13H3/t16-,17+,18-/m1/s1 |
| InChIKey | OSTBKBZRMPDCKZ-FGTMMUONSA-N |
| XLogP | 6.83 |
| TPSA | 123.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|