C36H32N2O3 — CID 11387144
3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]-N-phenylmethoxybenzamide (PubChem CID 11387144) has the molecular formula C36H32N2O3 and a molecular weight of 540.66 g/mol. Its IUPAC name is 3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]-N-phenylmethoxybenzamide.
| Compound Name | 3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 11387144 |
| Molecular Formula | C36H32N2O3 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]-N-phenylmethoxybenzamide |
| SMILES | O=C(NOCc1ccccc1)c1cccc(C[C@@H]2CCCC=C2c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C36H32N2O3/c39-35(38-40-25-26-13-4-1-5-14-26)31-21-12-15-27(24-31)23-30-20-10-11-22-32(30)36-37-33(28-16-6-2-7-17-28)34(41-36)29-18-8-3-9-19-29/h1-9,12-19,21-22,24,30H,10-11,20,23,25H2,(H,38,39)/t30-/m0/s1 |
| InChIKey | ZCWNNMZVVGSKSY-PMERELPUSA-N |
| XLogP | 8.30 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|