C23H30O15 — CID 11387236
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1R,2S,3R,4R,5S)-4-acetyloxy-2-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 11387236) has the molecular formula C23H30O15 and a molecular weight of 546.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1R,2S,3R,4R,5S)-4-acetyloxy-2-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1R,2S,3R,4R,5S)-4-acetyloxy-2-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11387236 |
| Molecular Formula | C23H30O15 |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1R,2S,3R,4R,5S)-4-acetyloxy-2-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H]3C[C@H](OC3=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H30O15/c1-8(24)31-7-15-18(33-10(3)26)20(34-11(4)27)21(35-12(5)28)23(37-15)38-19-16(29)13-6-14(36-22(13)30)17(19)32-9(2)25/h13-21,23,29H,6-7H2,1-5H3/t13-,14+,15-,16+,17-,18-,19-,20+,21-,23+/m1/s1 |
| InChIKey | ZKHYJPPCRBZNSU-WZWCEBQHSA-N |
| XLogP | -1.31 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|