C30H54O7Si — CID 11387342
[(2S,3S,4E,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-prop-2-enyloxan-3-yl] octanoate (PubChem CID 11387342) has the molecular formula C30H54O7Si and a molecular weight of 554.84 g/mol. Its IUPAC name is [(2S,3S,4E,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-prop-2-enyloxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-prop-2-enyloxan-3-yl] octanoate |
|---|---|
| PubChem CID | 11387342 |
| Molecular Formula | C30H54O7Si |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | [(2S,3S,4E,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-prop-2-enyloxan-3-yl] octanoate |
| SMILES | C=CC[C@@H]1C/C(=C\C(=O)OC)[C@H](OC(=O)CCCCCCC)[C@](OC)(C(C)(C)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C30H54O7Si/c1-12-14-15-16-17-19-25(31)36-27-23(21-26(32)33-8)20-24(18-13-2)37-30(27,34-9)29(6,7)22-35-38(10,11)28(3,4)5/h13,21,24,27H,2,12,14-20,22H2,1,3-11H3/b23-21+/t24-,27+,30-/m1/s1 |
| InChIKey | SJUHRUVQGLXGNN-AGCDVTSRSA-N |
| XLogP | 7.11 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|