C32H35N3O6 — CID 11387372
1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[3-(phenylmethoxycarbonylamino)propyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1,8-dicarboxylate (PubChem CID 11387372) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[3-(phenylmethoxycarbonylamino)propyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1,8-dicarboxylate.
| Compound Name | 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[3-(phenylmethoxycarbonylamino)propyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1,8-dicarboxylate |
|---|---|
| PubChem CID | 11387372 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[3-(phenylmethoxycarbonylamino)propyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1,8-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@@H]1[C@@H](CCN1C(=O)OCc1ccccc1)[C@H](CCCNC(=O)OCc1ccccc1)N2 |
| InChI | InChI=1S/C32H35N3O6/c1-39-30(36)24-14-15-28-26(19-24)29-25(16-18-35(29)32(38)41-21-23-11-6-3-7-12-23)27(34-28)13-8-17-33-31(37)40-20-22-9-4-2-5-10-22/h2-7,9-12,14-15,19,25,27,29,34H,8,13,16-18,20-21H2,1H3,(H,33,37)/t25-,27-,29-/m0/s1 |
| InChIKey | PEKUJTJZHHBDCL-RWPDHJIBSA-N |
| XLogP | 5.67 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|