C35H48O5S — CID 11387660
tert-butyl 2-[4-[(E)-3-[4-(2-cyclohexylsulfanylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate (PubChem CID 11387660) has the molecular formula C35H48O5S and a molecular weight of 580.83 g/mol. Its IUPAC name is tert-butyl 2-[4-[(E)-3-[4-(2-cyclohexylsulfanylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[4-[(E)-3-[4-(2-cyclohexylsulfanylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 11387660 |
| Molecular Formula | C35H48O5S |
| Molecular Weight | 580.83 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | tert-butyl 2-[4-[(E)-3-[4-(2-cyclohexylsulfanylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
| SMILES | Cc1cc(C(=O)/C=C/c2cc(C)c(OC(C)(C)C(=O)OC(C)(C)C)c(C)c2)cc(C)c1OCCSC1CCCCC1 |
| InChI | InChI=1S/C35H48O5S/c1-23-19-27(20-24(2)32(23)39-35(8,9)33(37)40-34(5,6)7)15-16-30(36)28-21-25(3)31(26(4)22-28)38-17-18-41-29-13-11-10-12-14-29/h15-16,19-22,29H,10-14,17-18H2,1-9H3/b16-15+ |
| InChIKey | QFZZVCOXXWTDJL-FOCLMDBBSA-N |
| XLogP | 8.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.83 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|