C31H62O6Si2 — CID 11387718
[(2S)-2-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]-2-hydroxyethyl] 2,2-dimethylpropanoate (PubChem CID 11387718) has the molecular formula C31H62O6Si2 and a molecular weight of 587.00 g/mol. Its IUPAC name is [(2S)-2-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]-2-hydroxyethyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]-2-hydroxyethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11387718 |
| Molecular Formula | C31H62O6Si2 |
| Molecular Weight | 587.00 g/mol |
| Exact Mass | 586.41 |
| IUPAC Name | [(2S)-2-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]-2-hydroxyethyl] 2,2-dimethylpropanoate |
| SMILES | CCCCC[C@H](/C=C/[C@@H](OCOCC[Si](C)(C)C)[C@@H]1C[C@H]1[C@H](O)COC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H62O6Si2/c1-13-14-15-16-24(37-39(11,12)31(5,6)7)17-18-28(36-23-34-19-20-38(8,9)10)26-21-25(26)27(32)22-35-29(33)30(2,3)4/h17-18,24-28,32H,13-16,19-23H2,1-12H3/b18-17+/t24-,25-,26-,27-,28-/m1/s1 |
| InChIKey | CLWQTUBHOZKVPX-AAQIFKTOSA-N |
| XLogP | 7.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.00 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|