C34H35N7O3 — CID 11387738
3-ethyl-19-methyl-7-[2-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-2-oxoethoxy]-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one (PubChem CID 11387738) has the molecular formula C34H35N7O3 and a molecular weight of 589.70 g/mol. Its IUPAC name is 3-ethyl-19-methyl-7-[2-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-2-oxoethoxy]-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one.
| Compound Name | 3-ethyl-19-methyl-7-[2-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-2-oxoethoxy]-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one |
|---|---|
| PubChem CID | 11387738 |
| Molecular Formula | C34H35N7O3 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 3-ethyl-19-methyl-7-[2-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-2-oxoethoxy]-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one |
| SMILES | CCn1c2ccc(OCC(=O)N3CCN(c4cccc(C)n4)CC3)cc2c2c3c(c4c(c21)CCc1nn(C)cc1-4)C(=O)NC3 |
| InChI | InChI=1S/C34H35N7O3/c1-4-41-27-11-8-21(44-19-29(42)40-14-12-39(13-15-40)28-7-5-6-20(2)36-28)16-23(27)31-24-17-35-34(43)32(24)30-22(33(31)41)9-10-26-25(30)18-38(3)37-26/h5-8,11,16,18H,4,9-10,12-15,17,19H2,1-3H3,(H,35,43) |
| InChIKey | ROFOYGJYTQRFTL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|