C31H29F5O4S — CID 11387760
6-(4-hydroxyphenyl)-5-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]naphthalen-2-ol (PubChem CID 11387760) has the molecular formula C31H29F5O4S and a molecular weight of 592.63 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-5-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]naphthalen-2-ol.
| Compound Name | 6-(4-hydroxyphenyl)-5-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]naphthalen-2-ol |
|---|---|
| PubChem CID | 11387760 |
| Molecular Formula | C31H29F5O4S |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 6-(4-hydroxyphenyl)-5-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]naphthalen-2-ol |
| SMILES | Oc1ccc(-c2ccc3cc(O)ccc3c2Oc2ccc(OCCCCSCCCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H29F5O4S/c32-30(33,31(34,35)36)16-3-19-41-18-2-1-17-39-25-10-12-26(13-11-25)40-29-27(21-4-7-23(37)8-5-21)14-6-22-20-24(38)9-15-28(22)29/h4-15,20,37-38H,1-3,16-19H2 |
| InChIKey | PSGFCWYPBYQXEY-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|