C41H60O2Si — CID 11387924
(6E,10E,14E)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,11,15,19-tetramethylicosa-1,6,10,14,18-pentaen-3-ol (PubChem CID 11387924) has the molecular formula C41H60O2Si and a molecular weight of 613.02 g/mol. Its IUPAC name is (6E,10E,14E)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,11,15,19-tetramethylicosa-1,6,10,14,18-pentaen-3-ol.
| Compound Name | (6E,10E,14E)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,11,15,19-tetramethylicosa-1,6,10,14,18-pentaen-3-ol |
|---|---|
| PubChem CID | 11387924 |
| Molecular Formula | C41H60O2Si |
| Molecular Weight | 613.02 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | (6E,10E,14E)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,11,15,19-tetramethylicosa-1,6,10,14,18-pentaen-3-ol |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(O)CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C41H60O2Si/c1-33(2)20-18-23-35(4)25-19-24-34(3)21-16-17-22-36(5)30-31-40(42)37(6)32-43-44(41(7,8)9,38-26-12-10-13-27-38)39-28-14-11-15-29-39/h10-15,20-22,25-29,40,42H,6,16-19,23-24,30-32H2,1-5,7-9H3/b34-21+,35-25+,36-22+ |
| InChIKey | SZHILCXPOLMMRQ-SXXKPQCTSA-N |
| XLogP | 10.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.02 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|