C10H12N2 — CID 11388
3-[(2S)-1,2,3,6-tetrahydropyridin-2-yl]pyridine (PubChem CID 11388) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-[(2S)-1,2,3,6-tetrahydropyridin-2-yl]pyridine.
| Compound Name | 3-[(2S)-1,2,3,6-tetrahydropyridin-2-yl]pyridine |
|---|---|
| PubChem CID | 11388 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-[(2S)-1,2,3,6-tetrahydropyridin-2-yl]pyridine |
| SMILES | C1=CC[C@@H](c2cccnc2)NC1 |
| InChI | InChI=1S/C10H12N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-4,6,8,10,12H,5,7H2/t10-/m0/s1 |
| InChIKey | SOPPBXUYQGUQHE-JTQLQIEISA-N |
| XLogP | 1.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|