C21H15Cl2IN4O3S2 — CID 11388059
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(2,4-dichlorophenyl)methyl]-4-iodo-N-methylbenzamide (PubChem CID 11388059) has the molecular formula C21H15Cl2IN4O3S2 and a molecular weight of 633.32 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(2,4-dichlorophenyl)methyl]-4-iodo-N-methylbenzamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(2,4-dichlorophenyl)methyl]-4-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 11388059 |
| Molecular Formula | C21H15Cl2IN4O3S2 |
| Molecular Weight | 633.32 g/mol |
| Exact Mass | 631.90 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(2,4-dichlorophenyl)methyl]-4-iodo-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Cl)cc1Cl)C(=O)c1ccc(I)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C21H15Cl2IN4O3S2/c1-28(11-12-5-6-13(22)9-16(12)23)21(29)15-8-7-14(24)10-18(15)27-33(30,31)19-4-2-3-17-20(19)26-32-25-17/h2-10,27H,11H2,1H3 |
| InChIKey | HIFTWELEAUDLGD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|