C34H64O7Si2 — CID 11388114
6-[(2S,3R,4S,5R,6R,7E,10R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-10-hydroxy-6-methoxy-3,5,8-trimethyldodeca-7,11-dienyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 11388114) has the molecular formula C34H64O7Si2 and a molecular weight of 641.05 g/mol. Its IUPAC name is 6-[(2S,3R,4S,5R,6R,7E,10R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-10-hydroxy-6-methoxy-3,5,8-trimethyldodeca-7,11-dienyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2S,3R,4S,5R,6R,7E,10R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-10-hydroxy-6-methoxy-3,5,8-trimethyldodeca-7,11-dienyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11388114 |
| Molecular Formula | C34H64O7Si2 |
| Molecular Weight | 641.05 g/mol |
| Exact Mass | 640.42 |
| IUPAC Name | 6-[(2S,3R,4S,5R,6R,7E,10R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-10-hydroxy-6-methoxy-3,5,8-trimethyldodeca-7,11-dienyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C=C[C@H](O)C/C(C)=C/[C@@H](OC)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](CC1=CC(=O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H64O7Si2/c1-18-26(35)19-23(2)20-28(37-13)24(3)31(41-43(16,17)33(8,9)10)25(4)29(40-42(14,15)32(5,6)7)21-27-22-30(36)39-34(11,12)38-27/h18,20,22,24-26,28-29,31,35H,1,19,21H2,2-17H3/b23-20+/t24-,25-,26+,28-,29+,31+/m1/s1 |
| InChIKey | FIIFECMQCOZFIC-NNTXWBNFSA-N |
| XLogP | 8.52 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.05 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|