C37H33ClN8O — CID 11388115
4-[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]anilino]-9-(2,6-dimethylphenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one (PubChem CID 11388115) has the molecular formula C37H33ClN8O and a molecular weight of 641.18 g/mol. Its IUPAC name is 4-[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]anilino]-9-(2,6-dimethylphenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one.
| Compound Name | 4-[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]anilino]-9-(2,6-dimethylphenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one |
|---|---|
| PubChem CID | 11388115 |
| Molecular Formula | C37H33ClN8O |
| Molecular Weight | 641.18 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | 4-[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]anilino]-9-(2,6-dimethylphenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one |
| SMILES | Cc1cccc(C)c1-n1c(=O)c2cnc(Nc3ccc(N4CCN(Cc5cccc(Cl)c5)CC4)cc3)nc2n2c3ccccc3nc12 |
| InChI | InChI=1S/C37H33ClN8O/c1-24-7-5-8-25(2)33(24)46-35(47)30-22-39-36(42-34(30)45-32-12-4-3-11-31(32)41-37(45)46)40-28-13-15-29(16-14-28)44-19-17-43(18-20-44)23-26-9-6-10-27(38)21-26/h3-16,21-22H,17-20,23H2,1-2H3,(H,39,40,42) |
| InChIKey | UUTMLGNEFWGTKF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 83.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.18 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|