C47H60N2O4 — CID 11388486
cis-bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] (1S,2R)-cyclopropane-1,2-dicarboxylate (PubChem CID 11388486) has the molecular formula C47H60N2O4 and a molecular weight of 717.01 g/mol. Its IUPAC name is cis-bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] (1S,2R)-cyclopropane-1,2-dicarboxylate.
| Compound Name | cis-bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] (1S,2R)-cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11388486 |
| Molecular Formula | C47H60N2O4 |
| Molecular Weight | 717.01 g/mol |
| Exact Mass | 716.46 |
| IUPAC Name | cis-bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] (1S,2R)-cyclopropane-1,2-dicarboxylate |
| SMILES | O=C(Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3)[C@H]1C[C@H]1C(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C47H60N2O4/c50-44(52-34-15-13-32-23-42-38-11-1-3-17-46(38,40(32)25-34)19-21-48(42)28-30-7-5-8-30)36-27-37(36)45(51)53-35-16-14-33-24-43-39-12-2-4-18-47(39,41(33)26-35)20-22-49(43)29-31-9-6-10-31/h13-16,25-26,30-31,36-39,42-43H,1-12,17-24,27-29H2/t36-,37+,38-,39-,42+,43+,46+,47+/m0/s1 |
| InChIKey | HFWQBUNFQOLPEO-JBILHQSLSA-N |
| XLogP | 8.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.01 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|