C39H76O7Si3 — CID 11388559
prop-2-enyl 2-[(2S,4S,6S,8R,10S)-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 11388559) has the molecular formula C39H76O7Si3 and a molecular weight of 741.29 g/mol. Its IUPAC name is prop-2-enyl 2-[(2S,4S,6S,8R,10S)-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | prop-2-enyl 2-[(2S,4S,6S,8R,10S)-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 11388559 |
| Molecular Formula | C39H76O7Si3 |
| Molecular Weight | 741.29 g/mol |
| Exact Mass | 740.49 |
| IUPAC Name | prop-2-enyl 2-[(2S,4S,6S,8R,10S)-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=CCOC(=O)C[C@H]1C[C@H](O[Si](CC)(CC)CC)C[C@@]2(C[C@@](C)(O[Si](CC)(CC)CC)C[C@H](CC(=C)[C@@H](C)CO[Si](CC)(CC)CC)O2)O1 |
| InChI | InChI=1S/C39H76O7Si3/c1-14-24-41-37(40)27-34-26-36(45-48(18-5,19-6)20-7)29-39(43-34)31-38(13,46-49(21-8,22-9)23-10)28-35(44-39)25-32(11)33(12)30-42-47(15-2,16-3)17-4/h14,33-36H,1,11,15-31H2,2-10,12-13H3/t33-,34+,35-,36-,38-,39+/m0/s1 |
| InChIKey | BSKKKOCBVILDRM-CBGPMYCUSA-N |
| XLogP | 10.94 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.29 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|