About (3S)-3-methylhexanal
(3S)-3-methylhexanal (PubChem CID 11389377) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is (3S)-3-methylhexanal.
Molecular Properties
| Compound Name | (3S)-3-methylhexanal |
| PubChem CID | 11389377 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | (3S)-3-methylhexanal |
| SMILES | CCC[C@H](C)CC=O |
| InChI | InChI=1S/C7H14O/c1-3-4-7(2)5-6-8/h6-7H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | ZSJUABCTGCNBPF-ZETCQYMHSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-methylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methylhexanal?
The IUPAC name of (3S)-3-methylhexanal (CID 11389377) is (3S)-3-methylhexanal.
What is the SMILES notation for (3S)-3-methylhexanal?
The canonical SMILES for (3S)-3-methylhexanal is CCC[C@H](C)CC=O.
What is the InChIKey of (3S)-3-methylhexanal?
The InChIKey is ZSJUABCTGCNBPF-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H14O/c1-3-4-7(2)5-6-8/h6-7H,3-5H2,1-2H3/t7-/m0/s1.
What are the key properties of (3S)-3-methylhexanal?
(3S)-3-methylhexanal has a molecular weight of 114.19 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methylhexanal is sourced from PubChem (CID 11389377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).